| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | c1ccc(cc1)S(=O)(=O)/N=C(/[C@H]2CCS(=O)(=O)C2)\[O-] |
| Molar mass | 302.01569 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.4306 |
| Number of basis functions | 317 |
| Zero Point Vibrational Energy | 0.246329 |
| InChI | InChI=1/C11H12NO5S2/c13-11(9-6-7-18(14,15)8-9)12-19(16,17)10-4-2-1-3-5-10/h1-5,9H,6-8H2/t9-/m0/s1 |
| Number of occupied orbitals | 79 |
| Energy at 0K | -1646.997534 |
| Input SMILES | [O-]/C(=N\S(=O)(=O)c1ccccc1)/[C@H]1CCS(=O)(=O)C1 |
| Number of orbitals | 317 |
| Number of virtual orbitals | 238 |
| Standard InChI | InChI=1S/C11H12NO5S2/c13-11(9-6-7-18(14,15)8-9)12-19(16,17)10-4-2-1-3-5-10/h1-5,9H,6-8H2/t9-/m0/s1 |
| Total Energy | -1646.981323 |
| Entropy | 2.213953D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1646.980379 |
| Standard InChI Key | InChIKey=NHMHQANZVOJKMP-VIFPVBQESA-N |
| Final Isomeric SMILES | [O][S]([O])([N]C(=O)[C@H]1CC[S]([O])(=O)C1)[C]2[CH][CH][CH][CH][CH]2 |
| SMILES | O=[C]([N][S]([O])([O])[C]1[CH][CH][CH][CH][CH]1)[C@H]1CC[S@](=O)([O])C1 |
| Gibbs energy | -1647.046388 |
| Thermal correction to Energy | 0.262539 |
| Thermal correction to Enthalpy | 0.263483 |
| Thermal correction to Gibbs energy | 0.197474 |