| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | c1ccc(c(c1)C(=O)N/N=C/[C@@H]([C@@H]([C@H]([C@H](CO)O)O[C@H]2[C@H]([C@@H]([C@@H]([C@@H](O2)CO)O)O)O)O)O)Cl |
| Molar mass | 494.13034 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.27605 |
| Number of basis functions | 553 |
| Zero Point Vibrational Energy | 0.519688 |
| InChI | InChI=1/C19H27ClN2O11/c20-9-4-2-1-3-8(9)18(31)22-21-5-10(25)13(27)17(11(26)6-23)33-19-16(30)15(29)14(28)12(7-24)32-19/h1-5,10-17,19,23-30H,6-7H2,(H,22,31)/b21-5+/t10-,11-,12-,13-,14+,15+,16-,17-,19-/m0/s1/f/h22H |
| Number of occupied orbitals | 130 |
| Energy at 0K | -2126.457811 |
| Input SMILES | OC[C@@H]([C@@H]([C@H]([C@H](/C=N/NC(=O)c1ccccc1Cl)O)O)O[C@@H]1O[C@@H](CO)[C@H]([C@H]([C@@H]1O)O)O)O |
| Number of orbitals | 553 |
| Number of virtual orbitals | 423 |
| Standard InChI | InChI=1S/C19H27ClN2O11/c20-9-4-2-1-3-8(9)18(31)22-21-5-10(25)13(27)17(11(26)6-23)33-19-16(30)15(29)14(28)12(7-24)32-19/h1-5,10-17,19,23-30H,6-7H2,(H,22,31)/b21-5+/t10-,11-,12-,13-,14+,15+,16-,17-,19-/m0/s1 |
| Total Energy | -2126.425739 |
| Entropy | 3.359215D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -2126.424795 |
| Standard InChI Key | InChIKey=ONEOSRKOICPMTP-MJSZGAIESA-N |
| Final Isomeric SMILES | OC[C@H](O)[C@H](O[C@@H]1O[C@@H](CO)[C@@H](O)[C@@H](O)[C@@H]1O)[C@@H](O)[C@@H](O)\C=N\NC(=O)[C]2[CH][CH][CH][CH][C]2Cl |
| SMILES | OC[C@@H]([C@@H]([C@H]([C@H](/C=N/NC(=O)[C]1[CH][CH][CH][CH][C]1Cl)O)O)O[C@@H]1O[C@@H](CO)[C@H]([C@H]([C@@H]1O)O)O)O |
| Gibbs energy | -2126.52495 |
| Thermal correction to Energy | 0.551759 |
| Thermal correction to Enthalpy | 0.552703 |
| Thermal correction to Gibbs energy | 0.452548 |