| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC1=C[C@H]2[C@@H](C[C@@H]3[C@@H]1[C@H](C[C@@]3(C)O)O)C(=C)C(=O)O2 |
| Molar mass | 264.13616 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 12.38952 |
| Number of basis functions | 325 |
| Zero Point Vibrational Energy | 0.357005 |
| InChI | InChI=1/C15H20O4/c1-7-4-12-9(8(2)14(17)19-12)5-10-13(7)11(16)6-15(10,3)18/h4,9-13,16,18H,2,5-6H2,1,3H3/t9-,10+,11-,12-,13+,15+/m0/s1 |
| Number of occupied orbitals | 71 |
| Energy at 0K | -878.71737 |
| Input SMILES | O[C@H]1C[C@@]([C@H]2[C@H]1C(=C[C@H]1[C@@H](C2)C(=C)C(=O)O1)C)(C)O |
| Number of orbitals | 325 |
| Number of virtual orbitals | 254 |
| Standard InChI | InChI=1S/C15H20O4/c1-7-4-12-9(8(2)14(17)19-12)5-10-13(7)11(16)6-15(10,3)18/h4,9-13,16,18H,2,5-6H2,1,3H3/t9-,10+,11-,12-,13+,15+/m0/s1 |
| Total Energy | -878.700873 |
| Entropy | 2.050813D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -878.699928 |
| Standard InChI Key | InChIKey=VNPALOJXXXSTCR-WBWNACRCSA-N |
| Final Isomeric SMILES | CC1=C[C@@H]2OC(=O)C(=C)[C@@H]2C[C@@H]3[C@@H]1[C@@H](O)C[C@@]3(C)O |
| SMILES | O[C@H]1C[C@@]([C@H]2[C@H]1C(=C[C@H]1[C@@H](C2)C(=C)C(=O)O1)C)(C)O |
| Gibbs energy | -878.761073 |
| Thermal correction to Energy | 0.373502 |
| Thermal correction to Enthalpy | 0.374446 |
| Thermal correction to Gibbs energy | 0.313302 |