| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(C)Cn1c(c(c(=O)[nH]c1=O)N(CC(C)C)C(=O)C[NH+]2CCC[C@H]2c3ccc4c(c3)OCCO4)N |
| Molar mass | 500.28729 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.85863 |
| Number of basis functions | 616 |
| Zero Point Vibrational Energy | 0.685593 |
| InChI | InChI=1/C26H40N5O5/c1-16(2)13-30(23-24(27)31(14-17(3)4)26(34)28-25(23)33)22(32)15-29-9-5-6-19(29)18-7-8-20-21(12-18)36-11-10-35-20/h7-8,12,16-17,19,23-24,29H,5-6,9-11,13-15,27H2,1-4H3,(H,28,33,34)/t19-,23+,24-/m0/s1/f/h28H |
| Number of occupied orbitals | 134 |
| Energy at 0K | -1652.44533 |
| Input SMILES | CC(CN(c1c(=O)[nH]c(=O)n(c1N)CC(C)C)C(=O)C[NH+]1CCC[C@H]1c1ccc2c(c1)OCCO2)C |
| Number of orbitals | 616 |
| Number of virtual orbitals | 482 |
| Standard InChI | InChI=1S/C26H40N5O5/c1-16(2)13-30(23-24(27)31(14-17(3)4)26(34)28-25(23)33)22(32)15-29-9-5-6-19(29)18-7-8-20-21(12-18)36-11-10-35-20/h7-8,12,16-17,19,23-24,29H,5-6,9-11,13-15,27H2,1-4H3,(H,28,33,34)/t19-,23+,24-/m0/s1 |
| Total Energy | -1652.411644 |
| Entropy | 3.528794D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1652.410699 |
| Standard InChI Key | InChIKey=UQVXDVYLGUUCOH-IEXUWNMDSA-N |
| Final Isomeric SMILES | CC(C)CN1[C@H](N)[C@@H](N(CC(C)C)C(=O)C[NH]2CCC[C@H]2c3ccc4OCCOc4c3)C(=O)NC1=O |
| SMILES | CC(CN([C@H]1C(=O)NC(=O)N([C@@H]1N)CC(C)C)C(=O)C[NH]1CCC[C@H]1c1ccc2c(c1)OCCO2)C |
| Gibbs energy | -1652.51591 |
| Thermal correction to Energy | 0.719279 |
| Thermal correction to Enthalpy | 0.720224 |
| Thermal correction to Gibbs energy | 0.615012 |
