| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC(=CCC[C@@](C)([C@H](C[C@H](/C(=C/COC[C@H]([C@H]([C@H]([C@H](CO)O)O)O)O)/C)OC(=O)C)O)O)C |
| Molar mass | 478.2778 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 13.29728 |
| Number of basis functions | 579 |
| Zero Point Vibrational Energy | 0.699927 |
| InChI | InChI=1/C23H42O10/c1-14(2)7-6-9-23(5,31)20(28)11-19(33-16(4)25)15(3)8-10-32-13-18(27)22(30)21(29)17(26)12-24/h7-8,17-22,24,26-31H,6,9-13H2,1-5H3/b15-8+/t17-,18+,19+,20-,21-,22+,23-/m0/s1 |
| Number of occupied orbitals | 130 |
| Energy at 0K | -1643.276963 |
| Input SMILES | OC[C@@H]([C@@H]([C@@H]([C@@H](COC/C=C(/[C@@H](C[C@@H]([C@](CCC=C(C)C)(O)C)O)OC(=O)C)\C)O)O)O)O |
| Number of orbitals | 579 |
| Number of virtual orbitals | 449 |
| Standard InChI | InChI=1S/C23H42O10/c1-14(2)7-6-9-23(5,31)20(28)11-19(33-16(4)25)15(3)8-10-32-13-18(27)22(30)21(29)17(26)12-24/h7-8,17-22,24,26-31H,6,9-13H2,1-5H3/b15-8+/t17-,18+,19+,20-,21-,22+,23-/m0/s1 |
| Total Energy | -1643.238595 |
| Entropy | 3.984471D-04 |
| Number of imaginary frequencies | 0 |
| Enthalpy | -1643.237651 |
| Standard InChI Key | InChIKey=YMJKKIHTFMHXTH-GAGMYMBKSA-N |
| Final Isomeric SMILES | CC(C)=CCC[C@](C)(O)[C@@H](O)C[C@@H](OC(C)=O)/C(C)=C/COC[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO |
| SMILES | OC[C@@H]([C@@H]([C@@H]([C@@H](COC/C=C(/[C@@H](C[C@@H]([C@](CCC=C(C)C)(O)C)O)OC(=O)C)\C)O)O)O)O |
| Gibbs energy | -1643.356448 |
| Thermal correction to Energy | 0.738295 |
| Thermal correction to Enthalpy | 0.739239 |
| Thermal correction to Gibbs energy | 0.620442 |