| Temperature | 298.15 |
| Wave Function / DFT | RHF |
| SMILES | CC#CCOc4ccc(S(=O)(=O)N3Cc1ccccc1N(C(=O)c2ccco2)CC3C(=O)NO)cc4 |
| Molar mass | 509.12567 |
| Pressure | 1 |
| Basis set | 6-31G(d) |
| HOMO-LUMO gap | 11.64148 |
| Number of basis functions | 590 |
| Zero Point Vibrational Energy | 0.489964 |
| InChI | InChI=1/C25H23N3O7S/c1-2-3-14-34-19-10-12-20(13-11-19)36(32,33)28-16-18-7-4-5-8-21(18)27(17-22(28)24(29)26-31)25(30)23-9-6-15-35-23/h4-13,15,22,31H,14,16-17H2,1H3,(H,26,29)/t22-/m0/s1/f/h26H |
| Number of occupied orbitals | 133 |
| Energy at 0K | -2044.282239 |
| Input SMILES | CC#CCOc1ccc(cc1)S(=O)(=O)N1Cc2ccccc2N(CC1C(=O)NO)C(=O)c1ccco1 |
| Number of orbitals | 590 |
| Number of virtual orbitals | 457 |
| Standard InChI | InChI=1S/C25H23N3O7S/c1-2-3-14-34-19-10-12-20(13-11-19)36(32,33)28-16-18-7-4-5-8-21(18)27(17-22(28)24(29)26-31)25(30)23-9-6-15-35-23/h4-13,15,22,31H,14,16-17H2,1H3,(H,26,29)/t22-/m0/s1 |
| Total Energy | -2044.252265 |
| Entropy | 3.267617D-04 |
| Number of imaginary frequencies | 1 |
| Enthalpy | -2044.251321 |
| Standard InChI Key | InChIKey=IVXFVTBAZBQGPK-QFIPXVFZSA-N |
| Final Isomeric SMILES | CC#CCOc1ccc(cc1)[S](=O)(=O)N2Cc3ccccc3N(C[C@H]2C(=O)NO)C(=O)c4occc4 |
| SMILES | CC#CCOc1ccc(cc1)S(=O)(=O)N1Cc2ccccc2N(C[C@H]1C(=O)NO)C(=O)c1ccco1 |
| Gibbs energy | -2044.348745 |
| Thermal correction to Energy | 0.519937 |
| Thermal correction to Enthalpy | 0.520881 |
| Thermal correction to Gibbs energy | 0.423458 |